C27H50N4O9 — CID 146719834
2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethyl 2-(5,5-dimethylhexylcarbamoyloxymethyl)-3-hydroxy-2-methylpropanoate (PubChem CID 146719834) has the molecular formula C27H50N4O9 and a molecular weight of 574.72 g/mol. Its IUPAC name is 2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethyl 2-(5,5-dimethylhexylcarbamoyloxymethyl)-3-hydroxy-2-methylpropanoate.
| Compound Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethyl 2-(5,5-dimethylhexylcarbamoyloxymethyl)-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 146719834 |
| Molecular Formula | C27H50N4O9 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethyl 2-(5,5-dimethylhexylcarbamoyloxymethyl)-3-hydroxy-2-methylpropanoate |
| SMILES | CC(C)(C)CCCCNC(=O)OCC(C)(CO)C(=O)OCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H50N4O9/c1-24(2,3)13-11-12-14-29-21(34)38-18-27(10,17-32)19(33)37-16-15-28-20(30-22(35)39-25(4,5)6)31-23(36)40-26(7,8)9/h32H,11-18H2,1-10H3,(H,29,34)(H2,28,30,31,35,36) |
| InChIKey | RERPYCUYBGTYSA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|