C23H32N2O5S — CID 146724482
1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]imidazolidine-2,4-dione (PubChem CID 146724482) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146724482 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[(E)-5-[[1-[3-(2,2-dimethylpropoxy)phenyl]cyclopropyl]methylsulfonyl]pent-2-enyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(C)COc1cccc(C2(CS(=O)(=O)CC/C=C/CN3CC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C23H32N2O5S/c1-22(2,3)16-30-19-9-7-8-18(14-19)23(10-11-23)17-31(28,29)13-6-4-5-12-25-15-20(26)24-21(25)27/h4-5,7-9,14H,6,10-13,15-17H2,1-3H3,(H,24,26,27)/b5-4+ |
| InChIKey | RFPYYYMLEUGWED-SNAWJCMRSA-N |
| XLogP | 3.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|