C24H38ClFN4O4 — CID 146728566
N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 146728566) has the molecular formula C24H38ClFN4O4 and a molecular weight of 501.04 g/mol. Its IUPAC name is N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146728566 |
| Molecular Formula | C24H38ClFN4O4 |
| Molecular Weight | 501.04 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-3-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | O=C(COC1CCC(Cl)C(F)C1)NC12CCC(NC(=O)C3CNC4CCCCN43)(CC1)CC2O |
| InChI | InChI=1S/C24H38ClFN4O4/c25-16-5-4-15(11-17(16)26)34-14-21(32)28-24-8-6-23(7-9-24,12-19(24)31)29-22(33)18-13-27-20-3-1-2-10-30(18)20/h15-20,27,31H,1-14H2,(H,28,32)(H,29,33) |
| InChIKey | NYNRSFVOROIHAD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.04 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|