About N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide
N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide (PubChem CID 14672963) has the molecular formula C5H7BrN4O3
and a molecular weight of 251.04 g/mol. Its IUPAC name is N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide.
Molecular Properties
| Compound Name | N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide |
| PubChem CID | 14672963 |
| Molecular Formula | C5H7BrN4O3 |
| Molecular Weight | 251.04 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide |
| SMILES | O=C(CBr)N1CCN=C1N[N+](=O)[O-] |
| InChI | InChI=1S/C5H7BrN4O3/c6-3-4(11)9-2-1-7-5(9)8-10(12)13/h1-3H2,(H,7,8) |
| InChIKey | AIQQETRCRYTACS-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.04 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide?
The IUPAC name of N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide (CID 14672963) is N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide.
What is the SMILES notation for N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide?
The canonical SMILES for N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide is O=C(CBr)N1CCN=C1N[N+](=O)[O-].
What is the InChIKey of N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide?
The InChIKey is AIQQETRCRYTACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrN4O3/c6-3-4(11)9-2-1-7-5(9)8-10(12)13/h1-3H2,(H,7,8).
What are the key properties of N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide?
N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide has a molecular weight of 251.04 g/mol, XLogP of -0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-bromoacetyl)-4,5-dihydroimidazol-2-yl]nitramide is sourced from PubChem (CID 14672963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).