C43H36BF3N2O3 — CID 146729783
11,17-bis(4-tert-butylphenyl)-14-(trifluoromethoxy)-3,25-dioxa-11,17-diaza-1-boraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene (PubChem CID 146729783) has the molecular formula C43H36BF3N2O3 and a molecular weight of 696.58 g/mol. Its IUPAC name is 11,17-bis(4-tert-butylphenyl)-14-(trifluoromethoxy)-3,25-dioxa-11,17-diaza-1-boraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene.
| Compound Name | 11,17-bis(4-tert-butylphenyl)-14-(trifluoromethoxy)-3,25-dioxa-11,17-diaza-1-boraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene |
|---|---|
| PubChem CID | 146729783 |
| Molecular Formula | C43H36BF3N2O3 |
| Molecular Weight | 696.58 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | 11,17-bis(4-tert-butylphenyl)-14-(trifluoromethoxy)-3,25-dioxa-11,17-diaza-1-boraheptacyclo[14.10.1.02,10.04,9.012,27.018,26.019,24]heptacosa-2(10),4,6,8,12,14,16(27),18(26),19,21,23-undecaene |
| SMILES | CC(C)(C)c1ccc(N2c3cc(OC(F)(F)F)cc4c3B(c3oc5ccccc5c32)c2oc3ccccc3c2N4c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C43H36BF3N2O3/c1-41(2,3)25-15-19-27(20-16-25)48-32-23-29(52-43(45,46)47)24-33-36(32)44(39-37(48)30-11-7-9-13-34(30)50-39)40-38(31-12-8-10-14-35(31)51-40)49(33)28-21-17-26(18-22-28)42(4,5)6/h7-24H,1-6H3 |
| InChIKey | RHEXOAFYDGCHLU-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.58 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|