C11H19F3O — CID 14673437
(1S)-2,2,2-trifluoro-1-[(1R,2S)-2-hexylcyclopropyl]ethanol (PubChem CID 14673437) has the molecular formula C11H19F3O and a molecular weight of 224.27 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-[(1R,2S)-2-hexylcyclopropyl]ethanol.
| Compound Name | (1S)-2,2,2-trifluoro-1-[(1R,2S)-2-hexylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 14673437 |
| Molecular Formula | C11H19F3O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-[(1R,2S)-2-hexylcyclopropyl]ethanol |
| SMILES | CCCCCC[C@H]1C[C@H]1[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3O/c1-2-3-4-5-6-8-7-9(8)10(15)11(12,13)14/h8-10,15H,2-7H2,1H3/t8-,9+,10-/m0/s1 |
| InChIKey | FVXMSVQNKYIKAK-AEJSXWLSSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|