C27H32F2I2N2O2 — CID 146735987
[4-(2-fluoro-2,2-diiodoethyl)-2-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]-[2-fluoro-4-(2-methylpropyl)phenyl]methanone (PubChem CID 146735987) has the molecular formula C27H32F2I2N2O2 and a molecular weight of 708.37 g/mol. Its IUPAC name is [4-(2-fluoro-2,2-diiodoethyl)-2-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]-[2-fluoro-4-(2-methylpropyl)phenyl]methanone.
| Compound Name | [4-(2-fluoro-2,2-diiodoethyl)-2-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]-[2-fluoro-4-(2-methylpropyl)phenyl]methanone |
|---|---|
| PubChem CID | 146735987 |
| Molecular Formula | C27H32F2I2N2O2 |
| Molecular Weight | 708.37 g/mol |
| Exact Mass | 708.05 |
| IUPAC Name | [4-(2-fluoro-2,2-diiodoethyl)-2-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]-[2-fluoro-4-(2-methylpropyl)phenyl]methanone |
| SMILES | CC(C)Cc1ccc(C(=O)N2CCC3(CC2)CN(CC(F)(I)I)CC(c2ccccc2)O3)c(F)c1 |
| InChI | InChI=1S/C27H32F2I2N2O2/c1-19(2)14-20-8-9-22(23(28)15-20)25(34)33-12-10-26(11-13-33)17-32(18-27(29,30)31)16-24(35-26)21-6-4-3-5-7-21/h3-9,15,19,24H,10-14,16-18H2,1-2H3 |
| InChIKey | RJDYXUGEZBAGPZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.37 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|