C26H25BN4O2 — CID 146738434
2-phenyl-4-pyridin-4-yl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 146738434) has the molecular formula C26H25BN4O2 and a molecular weight of 436.32 g/mol. Its IUPAC name is 2-phenyl-4-pyridin-4-yl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-pyridin-4-yl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 146738434 |
| Molecular Formula | C26H25BN4O2 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-phenyl-4-pyridin-4-yl-6-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cccc(-c3nc(-c4ccccc4)nc(-c4ccncc4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C26H25BN4O2/c1-25(2)26(3,4)33-27(32-25)21-12-8-11-20(17-21)24-30-22(18-9-6-5-7-10-18)29-23(31-24)19-13-15-28-16-14-19/h5-17H,1-4H3 |
| InChIKey | RJWNHFCNTCPPAL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|