C22H25N2+ — CID 146740117
5,6-dimethyl-1-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium (PubChem CID 146740117) has the molecular formula C22H25N2+ and a molecular weight of 317.46 g/mol. Its IUPAC name is 5,6-dimethyl-1-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 5,6-dimethyl-1-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 146740117 |
| Molecular Formula | C22H25N2+ |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 5,6-dimethyl-1-(2,4,6-trimethylphenyl)-5,6-dihydroimidazo[2,1-a]isoquinolin-4-ium |
| SMILES | Cc1cc(C)c(-n2cc[n+]3c2-c2ccccc2C(C)C3C)c(C)c1 |
| InChI | InChI=1S/C22H25N2/c1-14-12-15(2)21(16(3)13-14)24-11-10-23-18(5)17(4)19-8-6-7-9-20(19)22(23)24/h6-13,17-18H,1-5H3/q+1 |
| InChIKey | BHCMPGHUXQHTCV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|