C21H27FN2O6S — CID 146741581
1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]imidazolidine-2,4,5-trione (PubChem CID 146741581) has the molecular formula C21H27FN2O6S and a molecular weight of 454.52 g/mol. Its IUPAC name is 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 146741581 |
| Molecular Formula | C21H27FN2O6S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]imidazolidine-2,4,5-trione |
| SMILES | C[C@@H](CS(=O)(=O)CCCCCN1C(=O)NC(=O)C1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H27FN2O6S/c1-14(16-7-8-17(22)18(11-16)30-12-15-5-6-15)13-31(28,29)10-4-2-3-9-24-20(26)19(25)23-21(24)27/h7-8,11,14-15H,2-6,9-10,12-13H2,1H3,(H,23,25,27)/t14-/m0/s1 |
| InChIKey | RKXRHKWUZPKUEY-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|