C39H40F3N3O5 — CID 146742413
4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(3-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenyl]butan-1-one (PubChem CID 146742413) has the molecular formula C39H40F3N3O5 and a molecular weight of 687.76 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(3-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenyl]butan-1-one.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(3-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 146742413 |
| Molecular Formula | C39H40F3N3O5 |
| Molecular Weight | 687.76 g/mol |
| Exact Mass | 687.29 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4,5-bis(3-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]phenyl]butan-1-one |
| SMILES | COc1cccc(-c2nc(-c3ccc(C(F)(F)F)cc3)n(Cc3ccc(C(=O)CCCOCCOCCN)cc3)c2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C39H40F3N3O5/c1-47-33-8-3-6-30(24-33)36-37(31-7-4-9-34(25-31)48-2)45(38(44-36)29-15-17-32(18-16-29)39(40,41)42)26-27-11-13-28(14-12-27)35(46)10-5-20-49-22-23-50-21-19-43/h3-4,6-9,11-18,24-25H,5,10,19-23,26,43H2,1-2H3 |
| InChIKey | RLBSJCHSFTWUFO-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|