C35H36F7N3O6 — CID 146746397
[(3S,6R)-6-[2-[3-fluoro-5-[(3S)-3-(2-fluoroethoxycarbonylamino)-4,4-bis(4-fluorophenyl)-2-oxobutyl]-4-pyridinyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate (PubChem CID 146746397) has the molecular formula C35H36F7N3O6 and a molecular weight of 727.67 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[3-fluoro-5-[(3S)-3-(2-fluoroethoxycarbonylamino)-4,4-bis(4-fluorophenyl)-2-oxobutyl]-4-pyridinyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate.
| Compound Name | [(3S,6R)-6-[2-[3-fluoro-5-[(3S)-3-(2-fluoroethoxycarbonylamino)-4,4-bis(4-fluorophenyl)-2-oxobutyl]-4-pyridinyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 146746397 |
| Molecular Formula | C35H36F7N3O6 |
| Molecular Weight | 727.67 g/mol |
| Exact Mass | 727.25 |
| IUPAC Name | [(3S,6R)-6-[2-[3-fluoro-5-[(3S)-3-(2-fluoroethoxycarbonylamino)-4,4-bis(4-fluorophenyl)-2-oxobutyl]-4-pyridinyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
| SMILES | O=C(CCC(F)(F)F)OC[C@@H]1CO[C@H](CCc2c(F)cncc2CC(=O)[C@@H](NC(=O)OCCF)C(c2ccc(F)cc2)c2ccc(F)cc2)CN1 |
| InChI | InChI=1S/C35H36F7N3O6/c36-13-14-49-34(48)45-33(32(21-1-5-24(37)6-2-21)22-3-7-25(38)8-4-22)30(46)15-23-16-43-18-29(39)28(23)10-9-27-17-44-26(19-50-27)20-51-31(47)11-12-35(40,41)42/h1-8,16,18,26-27,32-33,44H,9-15,17,19-20H2,(H,45,48)/t26-,27+,33+/m0/s1 |
| InChIKey | RMBZMUCGSYVDFV-CLTMYIMISA-N |
| XLogP | 5.68 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |