C27H27N3O2 — CID 1467470
3-benzyl-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-phenylethyl)urea (PubChem CID 1467470) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-benzyl-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-phenylethyl)urea.
| Compound Name | 3-benzyl-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 1467470 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-benzyl-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-phenylethyl)urea |
| SMILES | Cc1cccc2cc(CN(CCc3ccccc3)C(=O)NCc3ccccc3)c(=O)[nH]c12 |
| InChI | InChI=1S/C27H27N3O2/c1-20-9-8-14-23-17-24(26(31)29-25(20)23)19-30(16-15-21-10-4-2-5-11-21)27(32)28-18-22-12-6-3-7-13-22/h2-14,17H,15-16,18-19H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | DWOIIVRVDLKQLO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |