C29H20N4O+2 — CID 146750773
3,5-dimethyl-23-oxa-6,12-diaza-2,29-diazonianonacyclo[17.10.2.11,7.02,6.012,31.013,18.022,30.024,29.011,32]dotriaconta-2,4,7(32),8,10,13,15,17,19(31),20,22(30),24,26,28-tetradecaene (PubChem CID 146750773) has the molecular formula C29H20N4O+2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 3,5-dimethyl-23-oxa-6,12-diaza-2,29-diazonianonacyclo[17.10.2.11,7.02,6.012,31.013,18.022,30.024,29.011,32]dotriaconta-2,4,7(32),8,10,13,15,17,19(31),20,22(30),24,26,28-tetradecaene.
| Compound Name | 3,5-dimethyl-23-oxa-6,12-diaza-2,29-diazonianonacyclo[17.10.2.11,7.02,6.012,31.013,18.022,30.024,29.011,32]dotriaconta-2,4,7(32),8,10,13,15,17,19(31),20,22(30),24,26,28-tetradecaene |
|---|---|
| PubChem CID | 146750773 |
| Molecular Formula | C29H20N4O+2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 3,5-dimethyl-23-oxa-6,12-diaza-2,29-diazonianonacyclo[17.10.2.11,7.02,6.012,31.013,18.022,30.024,29.011,32]dotriaconta-2,4,7(32),8,10,13,15,17,19(31),20,22(30),24,26,28-tetradecaene |
| SMILES | Cc1cc(C)[n+]2n1-c1cccc3c1C21c2c(ccc4c5ccccc5n-3c24)Oc2cccc[n+]21 |
| InChI | InChI=1S/C29H20N4O/c1-17-16-18(2)33-29-26-22(10-7-11-23(26)32(17)33)31-21-9-4-3-8-19(21)20-13-14-24(27(29)28(20)31)34-25-12-5-6-15-30(25)29/h3-16H,1-2H3/q+2 |
| InChIKey | FDACINACMPSUMX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|