C16H24O4 — CID 14675134
methyl (Z)-7-[(1R,4S,5R,6R)-6-formyl-4-methyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 14675134) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4S,5R,6R)-6-formyl-4-methyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4S,5R,6R)-6-formyl-4-methyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 14675134 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (Z)-7-[(1R,4S,5R,6R)-6-formyl-4-methyl-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](C=O)[C@H]2C[C@]1(C)CO2 |
| InChI | InChI=1S/C16H24O4/c1-16-9-14(20-11-16)12(10-17)13(16)7-5-3-4-6-8-15(18)19-2/h3,5,10,12-14H,4,6-9,11H2,1-2H3/b5-3-/t12-,13-,14-,16-/m1/s1 |
| InChIKey | GJLIKCRKCDUHLL-HRFUMEIUSA-N |
| XLogP | 2.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|