C28H39FO4 — CID 14675167
methyl (Z)-7-[(1R,4S,5R,6R)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate (PubChem CID 14675167) has the molecular formula C28H39FO4 and a molecular weight of 458.61 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4S,5R,6R)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4S,5R,6R)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 14675167 |
| Molecular Formula | C28H39FO4 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | methyl (Z)-7-[(1R,4S,5R,6R)-4-(4-fluorophenyl)-6-[(E,3R)-3-hydroxyoct-1-enyl]-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC)[C@@]2(c3ccc(F)cc3)CO[C@@H]1C2 |
| InChI | InChI=1S/C28H39FO4/c1-3-4-7-10-23(30)17-18-24-25(11-8-5-6-9-12-27(31)32-2)28(19-26(24)33-20-28)21-13-15-22(29)16-14-21/h5,8,13-18,23-26,30H,3-4,6-7,9-12,19-20H2,1-2H3/b8-5-,18-17+/t23-,24-,25-,26-,28-/m1/s1 |
| InChIKey | PWNQZCVJGNRLGG-VZFSPSFQSA-N |
| XLogP | 5.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|