C29H35FO4 — CID 14675294
(Z)-7-[(1R,4S,5R,6S)-6-[(2-fluorophenyl)methoxymethyl]-4-(2-phenylethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid (PubChem CID 14675294) has the molecular formula C29H35FO4 and a molecular weight of 466.59 g/mol. Its IUPAC name is (Z)-7-[(1R,4S,5R,6S)-6-[(2-fluorophenyl)methoxymethyl]-4-(2-phenylethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,4S,5R,6S)-6-[(2-fluorophenyl)methoxymethyl]-4-(2-phenylethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 14675294 |
| Molecular Formula | C29H35FO4 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (Z)-7-[(1R,4S,5R,6S)-6-[(2-fluorophenyl)methoxymethyl]-4-(2-phenylethyl)-2-oxabicyclo[2.2.1]heptan-5-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](COCc2ccccc2F)[C@H]2C[C@]1(CCc1ccccc1)CO2 |
| InChI | InChI=1S/C29H35FO4/c30-26-14-9-8-12-23(26)19-33-20-24-25(13-6-1-2-7-15-28(31)32)29(18-27(24)34-21-29)17-16-22-10-4-3-5-11-22/h1,3-6,8-12,14,24-25,27H,2,7,13,15-21H2,(H,31,32)/b6-1-/t24-,25-,27-,29-/m1/s1 |
| InChIKey | QVLBYVVNAMPUNR-VOJOEONTSA-N |
| XLogP | 6.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|