C18H24N4O5S — CID 146753782
(4R)-4-amino-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 146753782) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is (4R)-4-amino-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-4-amino-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 146753782 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (4R)-4-amino-2-[(Z)-N-hydroxy-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOc1cc([C@@H](CCC)NC(=O)[C@]2(N)CSC(/C(C)=N\O)=N2)oc(=O)c1 |
| InChI | InChI=1S/C18H24N4O5S/c1-4-6-13(14-8-12(26-7-5-2)9-15(23)27-14)20-17(24)18(19)10-28-16(21-18)11(3)22-25/h5,8-9,13,25H,2,4,6-7,10,19H2,1,3H3,(H,20,24)/b22-11-/t13-,18+/m1/s1 |
| InChIKey | RNXGAJIFWJHDEX-HLYBFYNGSA-N |
| XLogP | 1.81 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|