C19H27F2N — CID 146754551
(3Z,5E)-N-(4-cyclohexa-1,5-dien-1-ylbutyl)-N-ethyl-2,4-difluorohepta-1,3,5-trien-3-amine (PubChem CID 146754551) has the molecular formula C19H27F2N and a molecular weight of 307.43 g/mol. Its IUPAC name is (3Z,5E)-N-(4-cyclohexa-1,5-dien-1-ylbutyl)-N-ethyl-2,4-difluorohepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5E)-N-(4-cyclohexa-1,5-dien-1-ylbutyl)-N-ethyl-2,4-difluorohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 146754551 |
| Molecular Formula | C19H27F2N |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (3Z,5E)-N-(4-cyclohexa-1,5-dien-1-ylbutyl)-N-ethyl-2,4-difluorohepta-1,3,5-trien-3-amine |
| SMILES | C=C(F)/C(=C(F)\C=C\C)N(CC)CCCCC1=CCCC=C1 |
| InChI | InChI=1S/C19H27F2N/c1-4-11-18(21)19(16(3)20)22(5-2)15-10-9-14-17-12-7-6-8-13-17/h4,7,11-13H,3,5-6,8-10,14-15H2,1-2H3/b11-4+,19-18- |
| InChIKey | ROAWSORQHICMNK-ZMUUKXBTSA-N |
| XLogP | 6.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|