About 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene
2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene (PubChem CID 146761415) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene |
| PubChem CID | 146761415 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene |
| SMILES | C=CCC(CC)CCC1=CCC(C)C=C1C |
| InChI | InChI=1S/C16H26/c1-5-7-15(6-2)9-11-16-10-8-13(3)12-14(16)4/h5,10,12-13,15H,1,6-9,11H2,2-4H3 |
| InChIKey | RPMTWKXDPBUHGL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene?
The IUPAC name of 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene (CID 146761415) is 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene is C=CCC(CC)CCC1=CCC(C)C=C1C.
What is the InChIKey of 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene?
The InChIKey is RPMTWKXDPBUHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26/c1-5-7-15(6-2)9-11-16-10-8-13(3)12-14(16)4/h5,10,12-13,15H,1,6-9,11H2,2-4H3.
What are the key properties of 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene?
2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene has a molecular weight of 218.38 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylhex-5-enyl)-3,5-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 146761415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).