C13H23NO2 — CID 146762247
1-[(6R)-5-tert-butyl-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-methoxyethanone (PubChem CID 146762247) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-[(6R)-5-tert-butyl-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(6R)-5-tert-butyl-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 146762247 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-[(6R)-5-tert-butyl-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC=C(C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C13H23NO2/c1-10-11(13(2,3)4)7-6-8-14(10)12(15)9-16-5/h7,10H,6,8-9H2,1-5H3/t10-/m1/s1 |
| InChIKey | RPQVYDAJSOZPOX-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|