About 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate
1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate (PubChem CID 14676449) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate |
| PubChem CID | 14676449 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate |
| SMILES | CC(=O)OC(C)C1=C(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C13H20O3/c1-8-11(15)6-7-13(4,5)12(8)9(2)16-10(3)14/h9H,6-7H2,1-5H3 |
| InChIKey | SUCYGQDAKIIKLR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate?
The IUPAC name of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate (CID 14676449) is 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate.
What is the SMILES notation for 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate?
The canonical SMILES for 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate is CC(=O)OC(C)C1=C(C)C(=O)CCC1(C)C.
What is the InChIKey of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate?
The InChIKey is SUCYGQDAKIIKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-8-11(15)6-7-13(4,5)12(8)9(2)16-10(3)14/h9H,6-7H2,1-5H3.
What are the key properties of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate?
1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate has a molecular weight of 224.30 g/mol, XLogP of 2.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)ethyl acetate is sourced from PubChem (CID 14676449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).