About 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone
1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone (PubChem CID 146766580) has the molecular formula C26H35NO2
and a molecular weight of 393.57 g/mol. Its IUPAC name is 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone.
Molecular Properties
| Compound Name | 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone |
| PubChem CID | 146766580 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone |
| SMILES | CC(C)(C)CCOc1c(C(=O)CC2(c3ccccn3)CC2)cccc1C(C)(C)C |
| InChI | InChI=1S/C26H35NO2/c1-24(2,3)15-17-29-23-19(10-9-11-20(23)25(4,5)6)21(28)18-26(13-14-26)22-12-7-8-16-27-22/h7-12,16H,13-15,17-18H2,1-6H3 |
| InChIKey | RQSVZRKXWJCNMH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone?
The IUPAC name of 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone (CID 146766580) is 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone.
What is the SMILES notation for 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone?
The canonical SMILES for 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone is CC(C)(C)CCOc1c(C(=O)CC2(c3ccccn3)CC2)cccc1C(C)(C)C.
What is the InChIKey of 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone?
The InChIKey is RQSVZRKXWJCNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35NO2/c1-24(2,3)15-17-29-23-19(10-9-11-20(23)25(4,5)6)21(28)18-26(13-14-26)22-12-7-8-16-27-22/h7-12,16H,13-15,17-18H2,1-6H3.
What are the key properties of 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone?
1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone has a molecular weight of 393.57 g/mol, XLogP of 6.50, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-tert-butyl-2-(3,3-dimethylbutoxy)phenyl]-2-(1-pyridin-2-ylcyclopropyl)ethanone is sourced from PubChem (CID 146766580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).