About pentan-3-yl 3-oxobutanoate
pentan-3-yl 3-oxobutanoate (PubChem CID 14677137) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is pentan-3-yl 3-oxobutanoate.
Molecular Properties
| Compound Name | pentan-3-yl 3-oxobutanoate |
| PubChem CID | 14677137 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | pentan-3-yl 3-oxobutanoate |
| SMILES | CCC(CC)OC(=O)CC(C)=O |
| InChI | InChI=1S/C9H16O3/c1-4-8(5-2)12-9(11)6-7(3)10/h8H,4-6H2,1-3H3 |
| InChIKey | PFTIWTQFHWICDR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl 3-oxobutanoate?
The IUPAC name of pentan-3-yl 3-oxobutanoate (CID 14677137) is pentan-3-yl 3-oxobutanoate.
What is the SMILES notation for pentan-3-yl 3-oxobutanoate?
The canonical SMILES for pentan-3-yl 3-oxobutanoate is CCC(CC)OC(=O)CC(C)=O.
What is the InChIKey of pentan-3-yl 3-oxobutanoate?
The InChIKey is PFTIWTQFHWICDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-4-8(5-2)12-9(11)6-7(3)10/h8H,4-6H2,1-3H3.
What are the key properties of pentan-3-yl 3-oxobutanoate?
pentan-3-yl 3-oxobutanoate has a molecular weight of 172.22 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl 3-oxobutanoate is sourced from PubChem (CID 14677137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).