C25H24N2O3 — CID 146772852
[3-[4-nitro-3-(2-phenylethyl)phenyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 146772852) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is [3-[4-nitro-3-(2-phenylethyl)phenyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[4-nitro-3-(2-phenylethyl)phenyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 146772852 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [3-[4-nitro-3-(2-phenylethyl)phenyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cccc(-c2ccc([N+](=O)[O-])c(CCc3ccccc3)c2)c1)N1CCCC1 |
| InChI | InChI=1S/C25H24N2O3/c28-25(26-15-4-5-16-26)23-10-6-9-20(18-23)21-13-14-24(27(29)30)22(17-21)12-11-19-7-2-1-3-8-19/h1-3,6-10,13-14,17-18H,4-5,11-12,15-16H2 |
| InChIKey | RSBHXGUREGMTNQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|