C9H15NO — CID 146773660
1-[(3S)-3-ethyl-1,2,3,6-tetrahydropyridin-2-yl]ethenol (PubChem CID 146773660) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-[(3S)-3-ethyl-1,2,3,6-tetrahydropyridin-2-yl]ethenol.
| Compound Name | 1-[(3S)-3-ethyl-1,2,3,6-tetrahydropyridin-2-yl]ethenol |
|---|---|
| PubChem CID | 146773660 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-[(3S)-3-ethyl-1,2,3,6-tetrahydropyridin-2-yl]ethenol |
| SMILES | C=C(O)C1NCC=C[C@@H]1CC |
| InChI | InChI=1S/C9H15NO/c1-3-8-5-4-6-10-9(8)7(2)11/h4-5,8-11H,2-3,6H2,1H3/t8-,9?/m0/s1 |
| InChIKey | RSFLIEHXPYIRKR-IENPIDJESA-N |
| XLogP | 1.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|