About (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid
(E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 14677530) has the molecular formula C21H25FO4
and a molecular weight of 360.43 g/mol. Its IUPAC name is (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid.
Molecular Properties
| Compound Name | (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid |
| PubChem CID | 14677530 |
| Molecular Formula | C21H25FO4 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | O=C(O)CC(O)CC(O)/C=C/C1=C(c2ccc(F)cc2)CC2CCC1C2 |
| InChI | InChI=1S/C21H25FO4/c22-16-5-3-14(4-6-16)20-10-13-1-2-15(9-13)19(20)8-7-17(23)11-18(24)12-21(25)26/h3-8,13,15,17-18,23-24H,1-2,9-12H2,(H,25,26)/b8-7+ |
| InChIKey | WJNMTIRSXVROJY-BQYQJAHWSA-N |
| XLogP | 3.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid?
The IUPAC name of (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid (CID 14677530) is (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid.
What is the SMILES notation for (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid?
The canonical SMILES for (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid is O=C(O)CC(O)CC(O)/C=C/C1=C(c2ccc(F)cc2)CC2CCC1C2.
What is the InChIKey of (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid?
The InChIKey is WJNMTIRSXVROJY-BQYQJAHWSA-N. The full InChI is InChI=1S/C21H25FO4/c22-16-5-3-14(4-6-16)20-10-13-1-2-15(9-13)19(20)8-7-17(23)11-18(24)12-21(25)26/h3-8,13,15,17-18,23-24H,1-2,9-12H2,(H,25,26)/b8-7+.
What are the key properties of (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid?
(E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid has a molecular weight of 360.43 g/mol, XLogP of 3.54, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-[3-(4-fluorophenyl)-2-bicyclo[3.2.1]oct-2-enyl]-3,5-dihydroxyhept-6-enoic acid is sourced from PubChem (CID 14677530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).