C13H18N4O2S — CID 1467765
N-[2-(cyclopentylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide (PubChem CID 1467765) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1467765 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
| SMILES | C=CCN(CC(=O)NC1CCCC1)C(=O)c1csnn1 |
| InChI | InChI=1S/C13H18N4O2S/c1-2-7-17(13(19)11-9-20-16-15-11)8-12(18)14-10-5-3-4-6-10/h2,9-10H,1,3-8H2,(H,14,18) |
| InChIKey | VVBZJLHZXFKMLL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|