C16H13N5O3S2 — CID 146778445
N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide (PubChem CID 146778445) has the molecular formula C16H13N5O3S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 146778445 |
| Molecular Formula | C16H13N5O3S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-thiophen-2-ylbutan-2-yl)-4-pyridin-2-yl-1,2,5-thiadiazole-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1cccs1)NC(=O)c1nsnc1-c1ccccn1 |
| InChI | InChI=1S/C16H13N5O3S2/c17-15(23)14(22)11(8-9-4-3-7-25-9)19-16(24)13-12(20-26-21-13)10-5-1-2-6-18-10/h1-7,11H,8H2,(H2,17,23)(H,19,24) |
| InChIKey | RTELPSKDMCCQEG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|