About 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine
1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine (PubChem CID 146779452) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine.
Molecular Properties
| Compound Name | 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine |
| PubChem CID | 146779452 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine |
| SMILES | [H]/N=C(\N)N=C(C)/C(C)=C\C=C/C |
| InChI | InChI=1S/C9H15N3/c1-4-5-6-7(2)8(3)12-9(10)11/h4-6H,1-3H3,(H3,10,11)/b5-4-,7-6-,12-8? |
| InChIKey | RTJNIHIGCZLVCO-DSXQMJDFSA-N |
| XLogP | 1.86 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine?
The IUPAC name of 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine (CID 146779452) is 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine.
What is the SMILES notation for 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine?
The canonical SMILES for 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine is [H]/N=C(\N)N=C(C)/C(C)=C\C=C/C.
What is the InChIKey of 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine?
The InChIKey is RTJNIHIGCZLVCO-DSXQMJDFSA-N. The full InChI is InChI=1S/C9H15N3/c1-4-5-6-7(2)8(3)12-9(10)11/h4-6H,1-3H3,(H3,10,11)/b5-4-,7-6-,12-8?.
What are the key properties of 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine?
1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine has a molecular weight of 165.24 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z,5Z)-3-methylhepta-3,5-dien-2-ylidene]guanidine is sourced from PubChem (CID 146779452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).