C20H20F3N5O3 — CID 146781203
(9S)-4-methoxy-N-pyridin-2-yl-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 146781203) has the molecular formula C20H20F3N5O3 and a molecular weight of 435.41 g/mol. Its IUPAC name is (9S)-4-methoxy-N-pyridin-2-yl-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-methoxy-N-pyridin-2-yl-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 146781203 |
| Molecular Formula | C20H20F3N5O3 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (9S)-4-methoxy-N-pyridin-2-yl-5-(4,4,4-trifluorobutanoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | COc1cc2c(nc1C(=O)CCC(F)(F)F)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C20H20F3N5O3/c1-31-15-10-13-18(26-17(15)14(29)5-7-20(21,22)23)28(12-6-9-27(13)11-12)19(30)25-16-4-2-3-8-24-16/h2-4,8,10,12H,5-7,9,11H2,1H3,(H,24,25,30)/t12-/m0/s1 |
| InChIKey | RTRZHKUOGOUGHT-LBPRGKRZSA-N |
| XLogP | 3.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |