C15H13F2NO4 — CID 14678357
3-(2,4-difluoro-5-prop-2-ynoxyphenyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione (PubChem CID 14678357) has the molecular formula C15H13F2NO4 and a molecular weight of 309.27 g/mol. Its IUPAC name is 3-(2,4-difluoro-5-prop-2-ynoxyphenyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(2,4-difluoro-5-prop-2-ynoxyphenyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 14678357 |
| Molecular Formula | C15H13F2NO4 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-(2,4-difluoro-5-prop-2-ynoxyphenyl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione |
| SMILES | C#CCOc1cc(N2C(=O)OC(C(C)C)C2=O)c(F)cc1F |
| InChI | InChI=1S/C15H13F2NO4/c1-4-5-21-12-7-11(9(16)6-10(12)17)18-14(19)13(8(2)3)22-15(18)20/h1,6-8,13H,5H2,2-3H3 |
| InChIKey | ADGLRHMTNBIFOB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|