C30H24FN5O — CID 146784572
(5aR,6R,9aS)-1-[4-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 146784572) has the molecular formula C30H24FN5O and a molecular weight of 489.55 g/mol. Its IUPAC name is (5aR,6R,9aS)-1-[4-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-1-[4-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 146784572 |
| Molecular Formula | C30H24FN5O |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (5aR,6R,9aS)-1-[4-(5-fluoro-3-pyridinyl)phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-4-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccncc4)nn3-c3ccc(-c4cncc(F)c4)cc3)CC[C@H]12 |
| InChI | InChI=1S/C30H24FN5O/c1-18-26-8-7-25-27(20-9-11-33-12-10-20)35-36(29(25)30(26,2)14-22(15-32)28(18)37)24-5-3-19(4-6-24)21-13-23(31)17-34-16-21/h3-6,9-14,16-18,26H,7-8H2,1-2H3/t18-,26-,30-/m1/s1 |
| InChIKey | RUIKXTTWYQYVON-JJZKUNFFSA-N |
| XLogP | 5.62 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |