C30H39FN2O — CID 146786168
(1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine (PubChem CID 146786168) has the molecular formula C30H39FN2O and a molecular weight of 462.65 g/mol. Its IUPAC name is (1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine.
| Compound Name | (1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 146786168 |
| Molecular Formula | C30H39FN2O |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (1R,3R)-1-[4-[2-(3-ethylazetidin-1-yl)ethoxy]phenyl]-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine |
| SMILES | CCC1CN(CCOc2ccc([C@@H]3C4=C(C[C@@H](C)N3CC(C)(C)F)c3ccccc3C4)cc2)C1 |
| InChI | InChI=1S/C30H39FN2O/c1-5-22-18-32(19-22)14-15-34-25-12-10-23(11-13-25)29-28-17-24-8-6-7-9-26(24)27(28)16-21(2)33(29)20-30(3,4)31/h6-13,21-22,29H,5,14-20H2,1-4H3/t21-,29-/m1/s1 |
| InChIKey | RUXJTHVLONQOLF-ONOMSOESSA-N |
| XLogP | 6.30 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |