C27H25FNO+ — CID 146786178
2-(5-fluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium (PubChem CID 146786178) has the molecular formula C27H25FNO+ and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-(5-fluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(5-fluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 146786178 |
| Molecular Formula | C27H25FNO+ |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-(5-fluoro-9-methylnaphtho[2,1-b][1]benzofuran-8-yl)-1,5-dimethyl-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2cc(F)c4ccccc4c23)cc1C(C)C |
| InChI | InChI=1S/C27H25FNO/c1-15(2)21-12-23(29(5)14-17(21)4)25-16(3)10-11-20-26-19-9-7-6-8-18(19)22(28)13-24(26)30-27(20)25/h6-15H,1-5H3/q+1 |
| InChIKey | FNTHMSKIYPVCMM-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|