C17H23BrF3N3O2Si — CID 146787233
1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-5,5,5-trifluoropentan-1-one (PubChem CID 146787233) has the molecular formula C17H23BrF3N3O2Si and a molecular weight of 466.37 g/mol. Its IUPAC name is 1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 146787233 |
| Molecular Formula | C17H23BrF3N3O2Si |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 1-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-5,5,5-trifluoropentan-1-one |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)CCCC(F)(F)F)c2nc(Br)cnc21 |
| InChI | InChI=1S/C17H23BrF3N3O2Si/c1-27(2,3)8-7-26-11-24-10-12(13(25)5-4-6-17(19,20)21)15-16(24)22-9-14(18)23-15/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | RVCPHCJHLRYSBL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|