C20H39N — CID 14678759
N-(3,7-dimethyloctyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 14678759) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is N-(3,7-dimethyloctyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-(3,7-dimethyloctyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 14678759 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | N-(3,7-dimethyloctyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | CC(C)CCCC(C)CCNC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C20H39N/c1-16(2)7-6-8-17(3)13-14-21-20-12-11-18-9-4-5-10-19(18)15-20/h16-21H,4-15H2,1-3H3 |
| InChIKey | KZQIPNPAFDVCLF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |