C26H28FNO2 — CID 146788588
(4-methylphenyl) (3S)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]butanoate (PubChem CID 146788588) has the molecular formula C26H28FNO2 and a molecular weight of 405.51 g/mol. Its IUPAC name is (4-methylphenyl) (3S)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]butanoate.
| Compound Name | (4-methylphenyl) (3S)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]butanoate |
|---|---|
| PubChem CID | 146788588 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (4-methylphenyl) (3S)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]butanoate |
| SMILES | Cc1ccc(OC(=O)C[C@H](C)C2CCC(c3ccnc4ccc(F)cc34)CC2)cc1 |
| InChI | InChI=1S/C26H28FNO2/c1-17-3-10-22(11-4-17)30-26(29)15-18(2)19-5-7-20(8-6-19)23-13-14-28-25-12-9-21(27)16-24(23)25/h3-4,9-14,16,18-20H,5-8,15H2,1-2H3/t18-,19?,20?/m0/s1 |
| InChIKey | RVJGHROGITTWNT-HDYDNRTBSA-N |
| XLogP | 6.59 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|