C16H22F3NO3S2 — CID 146788870
2-[4-(4-propan-2-ylphenyl)butylsulfanyl]-N-(trifluoromethylsulfonyl)acetamide (PubChem CID 146788870) has the molecular formula C16H22F3NO3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[4-(4-propan-2-ylphenyl)butylsulfanyl]-N-(trifluoromethylsulfonyl)acetamide.
| Compound Name | 2-[4-(4-propan-2-ylphenyl)butylsulfanyl]-N-(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 146788870 |
| Molecular Formula | C16H22F3NO3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[4-(4-propan-2-ylphenyl)butylsulfanyl]-N-(trifluoromethylsulfonyl)acetamide |
| SMILES | CC(C)c1ccc(CCCCSCC(=O)NS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO3S2/c1-12(2)14-8-6-13(7-9-14)5-3-4-10-24-11-15(21)20-25(22,23)16(17,18)19/h6-9,12H,3-5,10-11H2,1-2H3,(H,20,21) |
| InChIKey | RVKQQFWZFCKYSQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|