C9H14O3 — CID 14679088
(2S,4R)-6-ethenyl-2,4-dimethoxy-3,4-dihydro-2H-pyran (PubChem CID 14679088) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2S,4R)-6-ethenyl-2,4-dimethoxy-3,4-dihydro-2H-pyran.
| Compound Name | (2S,4R)-6-ethenyl-2,4-dimethoxy-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 14679088 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2S,4R)-6-ethenyl-2,4-dimethoxy-3,4-dihydro-2H-pyran |
| SMILES | C=CC1=C[C@H](OC)C[C@@H](OC)O1 |
| InChI | InChI=1S/C9H14O3/c1-4-7-5-8(10-2)6-9(11-3)12-7/h4-5,8-9H,1,6H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | AJCYWVBXMAIZHM-IUCAKERBSA-N |
| XLogP | 1.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |