C10H16O4 — CID 14679095
(2S,3R,4S)-6-ethenyl-2,3,4-trimethoxy-3,4-dihydro-2H-pyran (PubChem CID 14679095) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2S,3R,4S)-6-ethenyl-2,3,4-trimethoxy-3,4-dihydro-2H-pyran.
| Compound Name | (2S,3R,4S)-6-ethenyl-2,3,4-trimethoxy-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 14679095 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2S,3R,4S)-6-ethenyl-2,3,4-trimethoxy-3,4-dihydro-2H-pyran |
| SMILES | C=CC1=C[C@H](OC)[C@@H](OC)[C@@H](OC)O1 |
| InChI | InChI=1S/C10H16O4/c1-5-7-6-8(11-2)9(12-3)10(13-4)14-7/h5-6,8-10H,1H2,2-4H3/t8-,9+,10-/m0/s1 |
| InChIKey | GDTGJQKLBHKBRN-AEJSXWLSSA-N |
| XLogP | 1.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |