C17H33NO2 — CID 146792696
(E)-5-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylpent-3-enamide (PubChem CID 146792696) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is (E)-5-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylpent-3-enamide.
| Compound Name | (E)-5-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylpent-3-enamide |
|---|---|
| PubChem CID | 146792696 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | (E)-5-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylpent-3-enamide |
| SMILES | CC(C)(C)CNC(=O)C(C)(C)/C=C/COCC(C)(C)C |
| InChI | InChI=1S/C17H33NO2/c1-15(2,3)12-18-14(19)17(7,8)10-9-11-20-13-16(4,5)6/h9-10H,11-13H2,1-8H3,(H,18,19)/b10-9+ |
| InChIKey | RWDNQHLVRYRZRT-MDZDMXLPSA-N |
| XLogP | 3.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|