C24H29FN2O — CID 146793309
[(2R)-2-[4-(cyclopentylamino)phenyl]piperidin-1-yl]-(2-fluoro-6-methylphenyl)methanone (PubChem CID 146793309) has the molecular formula C24H29FN2O and a molecular weight of 380.51 g/mol. Its IUPAC name is [(2R)-2-[4-(cyclopentylamino)phenyl]piperidin-1-yl]-(2-fluoro-6-methylphenyl)methanone.
| Compound Name | [(2R)-2-[4-(cyclopentylamino)phenyl]piperidin-1-yl]-(2-fluoro-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 146793309 |
| Molecular Formula | C24H29FN2O |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [(2R)-2-[4-(cyclopentylamino)phenyl]piperidin-1-yl]-(2-fluoro-6-methylphenyl)methanone |
| SMILES | Cc1cccc(F)c1C(=O)N1CCCC[C@@H]1c1ccc(NC2CCCC2)cc1 |
| InChI | InChI=1S/C24H29FN2O/c1-17-7-6-10-21(25)23(17)24(28)27-16-5-4-11-22(27)18-12-14-20(15-13-18)26-19-8-2-3-9-19/h6-7,10,12-15,19,22,26H,2-5,8-9,11,16H2,1H3/t22-/m1/s1 |
| InChIKey | RWGIIVHNVQDZEU-JOCHJYFZSA-N |
| XLogP | 5.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |