C23H21ClN4O2S2 — CID 146794041
N-(5-chloro-2-pyridinyl)-3-[2-oxo-2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]thiophene-2-carboxamide (PubChem CID 146794041) has the molecular formula C23H21ClN4O2S2 and a molecular weight of 485.03 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-[2-oxo-2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-[2-oxo-2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 146794041 |
| Molecular Formula | C23H21ClN4O2S2 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-[2-oxo-2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccsc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCSCC1 |
| InChI | InChI=1S/C23H21ClN4O2S2/c24-18-5-6-20(26-14-18)27-23(30)21-17(7-10-32-21)13-19(29)15-1-3-16(4-2-15)22(25)28-8-11-31-12-9-28/h1-7,10,14,25H,8-9,11-13H2,(H,26,27,30)/b25-22- |
| InChIKey | RWKBOAUBJZDYPE-LVWGJNHUSA-N |
| XLogP | 4.85 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|