About 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole
4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole (PubChem CID 14679835) has the molecular formula C9H11ClO2
and a molecular weight of 186.64 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
| PubChem CID | 14679835 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
| SMILES | CC1(C)OC2C=CC=C(Cl)C2O1 |
| InChI | InChI=1S/C9H11ClO2/c1-9(2)11-7-5-3-4-6(10)8(7)12-9/h3-5,7-8H,1-2H3 |
| InChIKey | HFZBUJZEUFTMKF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole?
The IUPAC name of 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole (CID 14679835) is 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole.
What is the SMILES notation for 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole?
The canonical SMILES for 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole is CC1(C)OC2C=CC=C(Cl)C2O1.
What is the InChIKey of 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole?
The InChIKey is HFZBUJZEUFTMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO2/c1-9(2)11-7-5-3-4-6(10)8(7)12-9/h3-5,7-8H,1-2H3.
What are the key properties of 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole?
4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole has a molecular weight of 186.64 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole is sourced from PubChem (CID 14679835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).