About 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol
4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol (PubChem CID 146799424) has the molecular formula C14H31NO2
and a molecular weight of 245.41 g/mol. Its IUPAC name is 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol |
| PubChem CID | 146799424 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)(O)CC(C)(C)NC(C)(C)CC(C)(C)O |
| InChI | InChI=1S/C14H31NO2/c1-11(2,9-13(5,6)16)15-12(3,4)10-14(7,8)17/h15-17H,9-10H2,1-8H3 |
| InChIKey | RXPHIEAWGCWNCS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol?
The IUPAC name of 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol (CID 146799424) is 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol?
The canonical SMILES for 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol is CC(C)(O)CC(C)(C)NC(C)(C)CC(C)(C)O.
What is the InChIKey of 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol?
The InChIKey is RXPHIEAWGCWNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO2/c1-11(2,9-13(5,6)16)15-12(3,4)10-14(7,8)17/h15-17H,9-10H2,1-8H3.
What are the key properties of 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol?
4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol has a molecular weight of 245.41 g/mol, XLogP of 2.46, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-hydroxy-2,4-dimethylpentan-2-yl)amino]-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 146799424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).