About 2-chloro-6,7-dihydro-5H-quinolin-8-one
2-chloro-6,7-dihydro-5H-quinolin-8-one (PubChem CID 14680112) has the molecular formula C9H8ClNO
and a molecular weight of 181.62 g/mol. Its IUPAC name is 2-chloro-6,7-dihydro-5H-quinolin-8-one.
Molecular Properties
| Compound Name | 2-chloro-6,7-dihydro-5H-quinolin-8-one |
| PubChem CID | 14680112 |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2-chloro-6,7-dihydro-5H-quinolin-8-one |
| SMILES | O=C1CCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H8ClNO/c10-8-5-4-6-2-1-3-7(12)9(6)11-8/h4-5H,1-3H2 |
| InChIKey | RNMYIMYXZYOOHG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,7-dihydro-5H-quinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,7-dihydro-5H-quinolin-8-one?
The IUPAC name of 2-chloro-6,7-dihydro-5H-quinolin-8-one (CID 14680112) is 2-chloro-6,7-dihydro-5H-quinolin-8-one.
What is the SMILES notation for 2-chloro-6,7-dihydro-5H-quinolin-8-one?
The canonical SMILES for 2-chloro-6,7-dihydro-5H-quinolin-8-one is O=C1CCCc2ccc(Cl)nc21.
What is the InChIKey of 2-chloro-6,7-dihydro-5H-quinolin-8-one?
The InChIKey is RNMYIMYXZYOOHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO/c10-8-5-4-6-2-1-3-7(12)9(6)11-8/h4-5H,1-3H2.
What are the key properties of 2-chloro-6,7-dihydro-5H-quinolin-8-one?
2-chloro-6,7-dihydro-5H-quinolin-8-one has a molecular weight of 181.62 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,7-dihydro-5H-quinolin-8-one is sourced from PubChem (CID 14680112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).