C19H21BFN4O3 — CID 146801222
CID 146801222 (PubChem CID 146801222) has the molecular formula C19H21BFN4O3 and a molecular weight of 383.21 g/mol.
| Compound Name | CID 146801222 |
|---|---|
| PubChem CID | 146801222 |
| Molecular Formula | C19H21BFN4O3 |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | — |
| SMILES | CC(=O)c1nn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)NCC2[B]C2)c2ccccc12 |
| InChI | InChI=1S/C19H21BFN4O3/c1-11(26)18-14-4-2-3-5-15(14)25(23-18)10-17(27)24-9-13(21)6-16(24)19(28)22-8-12-7-20-12/h2-5,12-13,16H,6-10H2,1H3,(H,22,28)/t12?,13-,16+/m1/s1 |
| InChIKey | RZMVZKZEWZVOSI-QVNUIZJESA-N |
| XLogP | 1.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|