About 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide
3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide (PubChem CID 146801249) has the molecular formula C14H16F2N3O4S+
and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide.
Molecular Properties
| Compound Name | 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide |
| PubChem CID | 146801249 |
| Molecular Formula | C14H16F2N3O4S+ |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(OCC(C)(F)F)[n+](=O)[nH]1 |
| InChI | InChI=1S/C14H16F2N3O4S/c1-3-24(21,22)11-5-4-8-17-13(11)10-6-7-12(19(20)18-10)23-9-14(2,15)16/h4-8H,3,9H2,1-2H3,(H,18,20)/q+1 |
| InChIKey | RXYGCPXALZQRJQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide?
The IUPAC name of 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide (CID 146801249) is 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide.
What is the SMILES notation for 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide?
The canonical SMILES for 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide is CCS(=O)(=O)c1cccnc1-c1ccc(OCC(C)(F)F)[n+](=O)[nH]1.
What is the InChIKey of 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide?
The InChIKey is RXYGCPXALZQRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N3O4S/c1-3-24(21,22)11-5-4-8-17-13(11)10-6-7-12(19(20)18-10)23-9-14(2,15)16/h4-8H,3,9H2,1-2H3,(H,18,20)/q+1.
What are the key properties of 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide?
3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide has a molecular weight of 360.36 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoropropoxy)-6-(3-ethylsulfonyl-2-pyridinyl)-1H-pyridazin-2-ium 2-oxide is sourced from PubChem (CID 146801249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).