C15H21ClN5O7P — CID 146802429
[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146802429) has the molecular formula C15H21ClN5O7P and a molecular weight of 449.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146802429 |
| Molecular Formula | C15H21ClN5O7P |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-chloro-7-(cyclobutylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2nnc3c(NC4CCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21ClN5O7P/c16-10-4-8(17-7-2-1-3-7)11-14(18-10)21(20-19-11)15-13(23)12(22)9(28-15)5-27-6-29(24,25)26/h4,7,9,12-13,15,22-23H,1-3,5-6H2,(H,17,18)(H2,24,25,26)/t9-,12-,13-,15-/m1/s1 |
| InChIKey | RYEFMVIJNLAKIN-QGMIFYJMSA-N |
| XLogP | 0.22 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|